C26H55N7O8 — CID 70864069
(2S)-4-amino-N-[(1R,3R,4R)-5-amino-4-[(2R,4R,5S)-3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy-2-[2-(8-aminooctylamino)ethoxy]-3-hydroxycyclohexyl]-2-hydroxybutanamide (PubChem CID 70864069) has the molecular formula C26H55N7O8 and a molecular weight of 593.77 g/mol. Its IUPAC name is (2S)-4-amino-N-[(1R,3R,4R)-5-amino-4-[(2R,4R,5S)-3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy-2-[2-(8-aminooctylamino)ethoxy]-3-hydroxycyclohexyl]-2-hydroxybutanamide.
| Compound Name | (2S)-4-amino-N-[(1R,3R,4R)-5-amino-4-[(2R,4R,5S)-3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy-2-[2-(8-aminooctylamino)ethoxy]-3-hydroxycyclohexyl]-2-hydroxybutanamide |
|---|---|
| PubChem CID | 70864069 |
| Molecular Formula | C26H55N7O8 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.41 |
| IUPAC Name | (2S)-4-amino-N-[(1R,3R,4R)-5-amino-4-[(2R,4R,5S)-3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy-2-[2-(8-aminooctylamino)ethoxy]-3-hydroxycyclohexyl]-2-hydroxybutanamide |
| SMILES | NCCCCCCCCNCCOC1[C@@H](O)[C@H](O[C@H]2OC(CN)[C@@H](O)[C@H](O)C2N)C(N)C[C@H]1NC(=O)[C@@H](O)CCN |
| InChI | InChI=1S/C26H55N7O8/c27-8-5-3-1-2-4-6-10-32-11-12-39-24-16(33-25(38)17(34)7-9-28)13-15(30)23(22(24)37)41-26-19(31)21(36)20(35)18(14-29)40-26/h15-24,26,32,34-37H,1-14,27-31H2,(H,33,38)/t15?,16-,17+,18?,19?,20-,21-,22+,23-,24?,26-/m1/s1 |
| InChIKey | QTYZUOCEUYKVQY-QTMZPPGWSA-N |
| XLogP | -4.34 |
| TPSA | 279.84 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|