About (4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine
(4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine (PubChem CID 70864159) has the molecular formula C14H26N2O
and a molecular weight of 238.37 g/mol. Its IUPAC name is (4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine.
Molecular Properties
| Compound Name | (4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine |
| PubChem CID | 70864159 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | (4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine |
| SMILES | CC1C[C@@H](C)C(OC[C@@H]2CCCNC2)=CC1N |
| InChI | InChI=1S/C14H26N2O/c1-10-6-11(2)14(7-13(10)15)17-9-12-4-3-5-16-8-12/h7,10-13,16H,3-6,8-9,15H2,1-2H3/t10?,11-,12-,13?/m1/s1 |
| InChIKey | JNIACMHKWPLPKF-QZQSVVMZSA-N |
| XLogP | 1.89 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine?
The IUPAC name of (4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine (CID 70864159) is (4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine.
What is the SMILES notation for (4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine?
The canonical SMILES for (4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine is CC1C[C@@H](C)C(OC[C@@H]2CCCNC2)=CC1N.
What is the InChIKey of (4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine?
The InChIKey is JNIACMHKWPLPKF-QZQSVVMZSA-N. The full InChI is InChI=1S/C14H26N2O/c1-10-6-11(2)14(7-13(10)15)17-9-12-4-3-5-16-8-12/h7,10-13,16H,3-6,8-9,15H2,1-2H3/t10?,11-,12-,13?/m1/s1.
What are the key properties of (4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine?
(4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine has a molecular weight of 238.37 g/mol, XLogP of 1.89, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4,6-dimethyl-3-[[(3R)-piperidin-3-yl]methoxy]cyclohex-2-en-1-amine is sourced from PubChem (CID 70864159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).