C20H28O — CID 70864200
3-(2-tricyclo[5.2.1.02,6]decanyl)-1,2,3,7,8,8a-hexahydronaphthalen-2-ol (PubChem CID 70864200) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is 3-(2-tricyclo[5.2.1.02,6]decanyl)-1,2,3,7,8,8a-hexahydronaphthalen-2-ol.
| Compound Name | 3-(2-tricyclo[5.2.1.02,6]decanyl)-1,2,3,7,8,8a-hexahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 70864200 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 3-(2-tricyclo[5.2.1.02,6]decanyl)-1,2,3,7,8,8a-hexahydronaphthalen-2-ol |
| SMILES | OC1CC2CCC=CC2=CC1C12CCCC1C1CCC2C1 |
| InChI | InChI=1S/C20H28O/c21-19-12-14-5-2-1-4-13(14)11-18(19)20-9-3-6-17(20)15-7-8-16(20)10-15/h1,4,11,14-19,21H,2-3,5-10,12H2 |
| InChIKey | SXQUISZWEHKCMH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |