About 2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine
2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 70864394) has the molecular formula C20H13FN4S
and a molecular weight of 360.42 g/mol. Its IUPAC name is 2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine.
Molecular Properties
| Compound Name | 2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine |
| PubChem CID | 70864394 |
| Molecular Formula | C20H13FN4S |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | Cc1ccc(F)c(-c2nc3ccc(-c4nc5ccncc5s4)cc3[nH]2)c1 |
| InChI | InChI=1S/C20H13FN4S/c1-11-2-4-14(21)13(8-11)19-23-15-5-3-12(9-17(15)24-19)20-25-16-6-7-22-10-18(16)26-20/h2-10H,1H3,(H,23,24) |
| InChIKey | KNSOKIPLVJPAJA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine?
The IUPAC name of 2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine (CID 70864394) is 2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine.
What is the SMILES notation for 2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine?
The canonical SMILES for 2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine is Cc1ccc(F)c(-c2nc3ccc(-c4nc5ccncc5s4)cc3[nH]2)c1.
What is the InChIKey of 2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine?
The InChIKey is KNSOKIPLVJPAJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13FN4S/c1-11-2-4-14(21)13(8-11)19-23-15-5-3-12(9-17(15)24-19)20-25-16-6-7-22-10-18(16)26-20/h2-10H,1H3,(H,23,24).
What are the key properties of 2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine?
2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine has a molecular weight of 360.42 g/mol, XLogP of 5.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-fluoro-5-methylphenyl)-3H-benzimidazol-5-yl]-[1,3]thiazolo[5,4-c]pyridine is sourced from PubChem (CID 70864394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).