About 6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole
6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole (PubChem CID 70864417) has the molecular formula C22H14N4OS
and a molecular weight of 382.45 g/mol. Its IUPAC name is 6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole |
| PubChem CID | 70864417 |
| Molecular Formula | C22H14N4OS |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole |
| SMILES | c1ccc(-c2ccc(-c3nc4c(-c5cn6ccsc6n5)cccc4[nH]3)o2)cc1 |
| InChI | InChI=1S/C22H14N4OS/c1-2-5-14(6-3-1)18-9-10-19(27-18)21-23-16-8-4-7-15(20(16)25-21)17-13-26-11-12-28-22(26)24-17/h1-13H,(H,23,25) |
| InChIKey | ZTJKWUCVHYQWRD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 59.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole?
The IUPAC name of 6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole (CID 70864417) is 6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole.
What is the SMILES notation for 6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole?
The canonical SMILES for 6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole is c1ccc(-c2ccc(-c3nc4c(-c5cn6ccsc6n5)cccc4[nH]3)o2)cc1.
What is the InChIKey of 6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole?
The InChIKey is ZTJKWUCVHYQWRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14N4OS/c1-2-5-14(6-3-1)18-9-10-19(27-18)21-23-16-8-4-7-15(20(16)25-21)17-13-26-11-12-28-22(26)24-17/h1-13H,(H,23,25).
What are the key properties of 6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole?
6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole has a molecular weight of 382.45 g/mol, XLogP of 5.87, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(5-phenylfuran-2-yl)-1H-benzimidazol-4-yl]imidazo[2,1-b][1,3]thiazole is sourced from PubChem (CID 70864417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).