C22H19N5OS — CID 70864424
4-[4-(6-imidazo[2,1-b][1,3]thiazol-6-yl-1H-benzimidazol-2-yl)phenyl]morpholine (PubChem CID 70864424) has the molecular formula C22H19N5OS and a molecular weight of 401.50 g/mol. Its IUPAC name is 4-[4-(6-imidazo[2,1-b][1,3]thiazol-6-yl-1H-benzimidazol-2-yl)phenyl]morpholine.
| Compound Name | 4-[4-(6-imidazo[2,1-b][1,3]thiazol-6-yl-1H-benzimidazol-2-yl)phenyl]morpholine |
|---|---|
| PubChem CID | 70864424 |
| Molecular Formula | C22H19N5OS |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 4-[4-(6-imidazo[2,1-b][1,3]thiazol-6-yl-1H-benzimidazol-2-yl)phenyl]morpholine |
| SMILES | c1cn2cc(-c3ccc4nc(-c5ccc(N6CCOCC6)cc5)[nH]c4c3)nc2s1 |
| InChI | InChI=1S/C22H19N5OS/c1-4-17(26-7-10-28-11-8-26)5-2-15(1)21-23-18-6-3-16(13-19(18)24-21)20-14-27-9-12-29-22(27)25-20/h1-6,9,12-14H,7-8,10-11H2,(H,23,24) |
| InChIKey | WTPYDDJTAGOJRS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|