C17H27N — CID 70864683
1-methyl-7-[(1R,5R)-3,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2,3,4,5-tetrahydroazepine (PubChem CID 70864683) has the molecular formula C17H27N and a molecular weight of 245.41 g/mol. Its IUPAC name is 1-methyl-7-[(1R,5R)-3,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2,3,4,5-tetrahydroazepine.
| Compound Name | 1-methyl-7-[(1R,5R)-3,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2,3,4,5-tetrahydroazepine |
|---|---|
| PubChem CID | 70864683 |
| Molecular Formula | C17H27N |
| Molecular Weight | 245.41 g/mol |
| Exact Mass | 245.21 |
| IUPAC Name | 1-methyl-7-[(1R,5R)-3,6,6-trimethyl-2-bicyclo[3.1.1]hept-2-enyl]-2,3,4,5-tetrahydroazepine |
| SMILES | CC1=C(C2=CCCCCN2C)[C@@H]2C[C@H](C1)C2(C)C |
| InChI | InChI=1S/C17H27N/c1-12-10-13-11-14(17(13,2)3)16(12)15-8-6-5-7-9-18(15)4/h8,13-14H,5-7,9-11H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | WHGCYCFJJDBFHP-KBPBESRZSA-N |
| XLogP | 4.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |