About 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine
4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine (PubChem CID 70865012) has the molecular formula C17H10Cl2FN5S
and a molecular weight of 406.27 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine.
Molecular Properties
| Compound Name | 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine |
| PubChem CID | 70865012 |
| Molecular Formula | C17H10Cl2FN5S |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.00 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine |
| SMILES | Nc1c(-c2ccnc(F)c2)sc(-c2cn[nH]n2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H10Cl2FN5S/c18-9-1-2-10(11(19)6-9)14-15(21)16(8-3-4-22-13(20)5-8)26-17(14)12-7-23-25-24-12/h1-7H,21H2,(H,23,24,25) |
| InChIKey | ZWKWEZRERMKYIN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine?
The IUPAC name of 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine (CID 70865012) is 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine.
What is the SMILES notation for 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine?
The canonical SMILES for 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine is Nc1c(-c2ccnc(F)c2)sc(-c2cn[nH]n2)c1-c1ccc(Cl)cc1Cl.
What is the InChIKey of 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine?
The InChIKey is ZWKWEZRERMKYIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10Cl2FN5S/c18-9-1-2-10(11(19)6-9)14-15(21)16(8-3-4-22-13(20)5-8)26-17(14)12-7-23-25-24-12/h1-7H,21H2,(H,23,24,25).
What are the key properties of 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine?
4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine has a molecular weight of 406.27 g/mol, XLogP of 5.29, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorophenyl)-2-(2-fluoro-4-pyridinyl)-5-(2H-triazol-4-yl)thiophen-3-amine is sourced from PubChem (CID 70865012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).