C17H22F3N3O3 — CID 70865337
tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 70865337) has the molecular formula C17H22F3N3O3 and a molecular weight of 373.38 g/mol. Its IUPAC name is tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70865337 |
| Molecular Formula | C17H22F3N3O3 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | tert-butyl 2-[[6-(trifluoromethyl)-2-pyridinyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1C(=O)Nc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C17H22F3N3O3/c1-16(2,3)26-15(25)23-10-5-4-7-11(23)14(24)22-13-9-6-8-12(21-13)17(18,19)20/h6,8-9,11H,4-5,7,10H2,1-3H3,(H,21,22,24) |
| InChIKey | ARPLYEUBOAKLAX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |