C29H34N4O2 — CID 70865486
4-[4-[2-[7-(3-hydroxybutyl)-1H-indol-3-yl]ethylamino]-3-methylanilino]-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol (PubChem CID 70865486) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 4-[4-[2-[7-(3-hydroxybutyl)-1H-indol-3-yl]ethylamino]-3-methylanilino]-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol.
| Compound Name | 4-[4-[2-[7-(3-hydroxybutyl)-1H-indol-3-yl]ethylamino]-3-methylanilino]-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol |
|---|---|
| PubChem CID | 70865486 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 4-[4-[2-[7-(3-hydroxybutyl)-1H-indol-3-yl]ethylamino]-3-methylanilino]-6,7-dihydro-5H-cyclopenta[b]pyridin-7-ol |
| SMILES | Cc1cc(Nc2ccnc3c2CCC3O)ccc1NCCc1c[nH]c2c(CCC(C)O)cccc12 |
| InChI | InChI=1S/C29H34N4O2/c1-18-16-22(33-26-13-15-31-29-24(26)9-11-27(29)35)8-10-25(18)30-14-12-21-17-32-28-20(7-6-19(2)34)4-3-5-23(21)28/h3-5,8,10,13,15-17,19,27,30,32,34-35H,6-7,9,11-12,14H2,1-2H3,(H,31,33) |
| InChIKey | KQJDLSVPYDJWAT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|