C26H42N2 — CID 70865570
(Z)-N-[2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-N'-[2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl]ethene-1,2-diamine (PubChem CID 70865570) has the molecular formula C26H42N2 and a molecular weight of 382.64 g/mol. Its IUPAC name is (Z)-N-[2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-N'-[2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl]ethene-1,2-diamine.
| Compound Name | (Z)-N-[2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-N'-[2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl]ethene-1,2-diamine |
|---|---|
| PubChem CID | 70865570 |
| Molecular Formula | C26H42N2 |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 382.33 |
| IUPAC Name | (Z)-N-[2,6-di(propan-2-yl)cyclohexa-1,3-dien-1-yl]-N'-[2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-yl]ethene-1,2-diamine |
| SMILES | CC(C)C1=CCCC(C(C)C)=C1N/C=C\NC1=C(C(C)C)C=CCC1C(C)C |
| InChI | InChI=1S/C26H42N2/c1-17(2)21-11-9-12-22(18(3)4)25(21)27-15-16-28-26-23(19(5)6)13-10-14-24(26)20(7)8/h9,11,13,15-20,22,27-28H,10,12,14H2,1-8H3/b16-15- |
| InChIKey | WABHOEACBWKZRA-NXVVXOECSA-N |
| XLogP | 7.07 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |