About 2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile
2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile (PubChem CID 70865669) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile |
| PubChem CID | 70865669 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile |
| SMILES | C/C=C\C=c1\c(CC#N)c[nH]\c1=C/C(C)O |
| InChI | InChI=1S/C13H16N2O/c1-3-4-5-12-11(6-7-14)9-15-13(12)8-10(2)16/h3-5,8-10,15-16H,6H2,1-2H3/b4-3-,12-5-,13-8- |
| InChIKey | NDXLCGXTEWQCAQ-DPGQEAITSA-N |
| XLogP | 0.60 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile?
The IUPAC name of 2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile (CID 70865669) is 2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile.
What is the SMILES notation for 2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile?
The canonical SMILES for 2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile is C/C=C\C=c1\c(CC#N)c[nH]\c1=C/C(C)O.
What is the InChIKey of 2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile?
The InChIKey is NDXLCGXTEWQCAQ-DPGQEAITSA-N. The full InChI is InChI=1S/C13H16N2O/c1-3-4-5-12-11(6-7-14)9-15-13(12)8-10(2)16/h3-5,8-10,15-16H,6H2,1-2H3/b4-3-,12-5-,13-8-.
What are the key properties of 2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile?
2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile has a molecular weight of 216.28 g/mol, XLogP of 0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4Z,5Z)-4-[(Z)-but-2-enylidene]-5-(2-hydroxypropylidene)-1H-pyrrol-3-yl]acetonitrile is sourced from PubChem (CID 70865669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).