C21H25N5 — CID 70865725
4-(12-cyclobutyl-1,3,8,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5,8-tetraen-5-yl)-N-methylaniline (PubChem CID 70865725) has the molecular formula C21H25N5 and a molecular weight of 347.47 g/mol. Its IUPAC name is 4-(12-cyclobutyl-1,3,8,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5,8-tetraen-5-yl)-N-methylaniline.
| Compound Name | 4-(12-cyclobutyl-1,3,8,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5,8-tetraen-5-yl)-N-methylaniline |
|---|---|
| PubChem CID | 70865725 |
| Molecular Formula | C21H25N5 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 4-(12-cyclobutyl-1,3,8,12-tetrazatricyclo[7.5.0.02,7]tetradeca-2(7),3,5,8-tetraen-5-yl)-N-methylaniline |
| SMILES | CNc1ccc(-c2cnc3c(c2)nc2n3CCN(C3CCC3)CC2)cc1 |
| InChI | InChI=1S/C21H25N5/c1-22-17-7-5-15(6-8-17)16-13-19-21(23-14-16)26-12-11-25(18-3-2-4-18)10-9-20(26)24-19/h5-8,13-14,18,22H,2-4,9-12H2,1H3 |
| InChIKey | BQORUESYXPEJMT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |