C23H32N6S — CID 70865749
N-(3-cyclobutyl-1,2,4,5-tetrahydro-[1,4]diazepino[1,7-a]benzimidazol-8-yl)-N'-ethyl-N-methyl-N'-(1,3-thiazol-2-yl)ethane-1,2-diamine (PubChem CID 70865749) has the molecular formula C23H32N6S and a molecular weight of 424.62 g/mol. Its IUPAC name is N-(3-cyclobutyl-1,2,4,5-tetrahydro-[1,4]diazepino[1,7-a]benzimidazol-8-yl)-N'-ethyl-N-methyl-N'-(1,3-thiazol-2-yl)ethane-1,2-diamine.
| Compound Name | N-(3-cyclobutyl-1,2,4,5-tetrahydro-[1,4]diazepino[1,7-a]benzimidazol-8-yl)-N'-ethyl-N-methyl-N'-(1,3-thiazol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 70865749 |
| Molecular Formula | C23H32N6S |
| Molecular Weight | 424.62 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | N-(3-cyclobutyl-1,2,4,5-tetrahydro-[1,4]diazepino[1,7-a]benzimidazol-8-yl)-N'-ethyl-N-methyl-N'-(1,3-thiazol-2-yl)ethane-1,2-diamine |
| SMILES | CCN(CCN(C)c1ccc2c(c1)nc1n2CCN(C2CCC2)CC1)c1nccs1 |
| InChI | InChI=1S/C23H32N6S/c1-3-27(23-24-10-16-30-23)13-12-26(2)19-7-8-21-20(17-19)25-22-9-11-28(14-15-29(21)22)18-5-4-6-18/h7-8,10,16-18H,3-6,9,11-15H2,1-2H3 |
| InChIKey | QJXDMNAEYQNNHW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 40.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.62 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |