C21H32N4O — CID 70865776
N-[2-[1-ethyl-5-(morpholin-4-ylmethyl)benzimidazol-2-yl]ethyl]-N-methylcyclobutanamine (PubChem CID 70865776) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is N-[2-[1-ethyl-5-(morpholin-4-ylmethyl)benzimidazol-2-yl]ethyl]-N-methylcyclobutanamine.
| Compound Name | N-[2-[1-ethyl-5-(morpholin-4-ylmethyl)benzimidazol-2-yl]ethyl]-N-methylcyclobutanamine |
|---|---|
| PubChem CID | 70865776 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | N-[2-[1-ethyl-5-(morpholin-4-ylmethyl)benzimidazol-2-yl]ethyl]-N-methylcyclobutanamine |
| SMILES | CCn1c(CCN(C)C2CCC2)nc2cc(CN3CCOCC3)ccc21 |
| InChI | InChI=1S/C21H32N4O/c1-3-25-20-8-7-17(16-24-11-13-26-14-12-24)15-19(20)22-21(25)9-10-23(2)18-5-4-6-18/h7-8,15,18H,3-6,9-14,16H2,1-2H3 |
| InChIKey | RCBLHKSVDAMQML-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |