About 3,4-ditert-butyl-2-phenyl-1,3-thiazolidine
3,4-ditert-butyl-2-phenyl-1,3-thiazolidine (PubChem CID 70865831) has the molecular formula C17H27NS
and a molecular weight of 277.48 g/mol. Its IUPAC name is 3,4-ditert-butyl-2-phenyl-1,3-thiazolidine.
Molecular Properties
| Compound Name | 3,4-ditert-butyl-2-phenyl-1,3-thiazolidine |
| PubChem CID | 70865831 |
| Molecular Formula | C17H27NS |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 3,4-ditert-butyl-2-phenyl-1,3-thiazolidine |
| SMILES | CC(C)(C)C1CSC(c2ccccc2)N1C(C)(C)C |
| InChI | InChI=1S/C17H27NS/c1-16(2,3)14-12-19-15(18(14)17(4,5)6)13-10-8-7-9-11-13/h7-11,14-15H,12H2,1-6H3 |
| InChIKey | KEWFKFXBLHWIND-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,4-ditert-butyl-2-phenyl-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-ditert-butyl-2-phenyl-1,3-thiazolidine?
The IUPAC name of 3,4-ditert-butyl-2-phenyl-1,3-thiazolidine (CID 70865831) is 3,4-ditert-butyl-2-phenyl-1,3-thiazolidine.
What is the SMILES notation for 3,4-ditert-butyl-2-phenyl-1,3-thiazolidine?
The canonical SMILES for 3,4-ditert-butyl-2-phenyl-1,3-thiazolidine is CC(C)(C)C1CSC(c2ccccc2)N1C(C)(C)C.
What is the InChIKey of 3,4-ditert-butyl-2-phenyl-1,3-thiazolidine?
The InChIKey is KEWFKFXBLHWIND-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NS/c1-16(2,3)14-12-19-15(18(14)17(4,5)6)13-10-8-7-9-11-13/h7-11,14-15H,12H2,1-6H3.
What are the key properties of 3,4-ditert-butyl-2-phenyl-1,3-thiazolidine?
3,4-ditert-butyl-2-phenyl-1,3-thiazolidine has a molecular weight of 277.48 g/mol, XLogP of 4.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-ditert-butyl-2-phenyl-1,3-thiazolidine is sourced from PubChem (CID 70865831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).