C22H29FO3S — CID 70865887
(Z)-7-[(1R,3R)-2-[(E)-4-(2-fluorophenyl)sulfanylbut-1-enyl]-3-hydroxycyclopentyl]hept-5-enoic acid (PubChem CID 70865887) has the molecular formula C22H29FO3S and a molecular weight of 392.54 g/mol. Its IUPAC name is (Z)-7-[(1R,3R)-2-[(E)-4-(2-fluorophenyl)sulfanylbut-1-enyl]-3-hydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,3R)-2-[(E)-4-(2-fluorophenyl)sulfanylbut-1-enyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70865887 |
| Molecular Formula | C22H29FO3S |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (Z)-7-[(1R,3R)-2-[(E)-4-(2-fluorophenyl)sulfanylbut-1-enyl]-3-hydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1CC[C@@H](O)C1/C=C/CCSc1ccccc1F |
| InChI | InChI=1S/C22H29FO3S/c23-19-11-5-6-12-21(19)27-16-8-7-10-18-17(14-15-20(18)24)9-3-1-2-4-13-22(25)26/h1,3,5-7,10-12,17-18,20,24H,2,4,8-9,13-16H2,(H,25,26)/b3-1-,10-7+/t17-,18?,20+/m0/s1 |
| InChIKey | FDCSPSISIBOFKJ-BGQSCYCDSA-N |
| XLogP | 5.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|