C23H28F2N4O2 — CID 70866298
N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-9-(3,4-difluorophenyl)-2-methyl-1,3,4,7-tetrahydropyrido[3,4-c]azepine-6-carboxamide (PubChem CID 70866298) has the molecular formula C23H28F2N4O2 and a molecular weight of 430.50 g/mol. Its IUPAC name is N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-9-(3,4-difluorophenyl)-2-methyl-1,3,4,7-tetrahydropyrido[3,4-c]azepine-6-carboxamide.
| Compound Name | N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-9-(3,4-difluorophenyl)-2-methyl-1,3,4,7-tetrahydropyrido[3,4-c]azepine-6-carboxamide |
|---|---|
| PubChem CID | 70866298 |
| Molecular Formula | C23H28F2N4O2 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-9-(3,4-difluorophenyl)-2-methyl-1,3,4,7-tetrahydropyrido[3,4-c]azepine-6-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)C1=CC2=C(CN(C)CC2)C(c2ccc(F)c(F)c2)=NC1)C(N)=O |
| InChI | InChI=1S/C23H28F2N4O2/c1-13(2)8-20(22(26)30)28-23(31)16-9-14-6-7-29(3)12-17(14)21(27-11-16)15-4-5-18(24)19(25)10-15/h4-5,9-10,13,20H,6-8,11-12H2,1-3H3,(H2,26,30)(H,28,31)/t20-/m0/s1 |
| InChIKey | CEBKURMEWVSDGQ-FQEVSTJZSA-N |
| XLogP | 2.34 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |