About [4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid
[4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid (PubChem CID 70866324) has the molecular formula C18H16F2O5S
and a molecular weight of 382.38 g/mol. Its IUPAC name is [4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid.
Molecular Properties
| Compound Name | [4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid |
| PubChem CID | 70866324 |
| Molecular Formula | C18H16F2O5S |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | [4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid |
| SMILES | CCOC(=O)C(C(=O)c1ccc(CS(=O)O)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H16F2O5S/c1-2-25-18(22)16(14-8-7-13(19)9-15(14)20)17(21)12-5-3-11(4-6-12)10-26(23)24/h3-9,16H,2,10H2,1H3,(H,23,24) |
| InChIKey | SDJPTZBMDCPQHE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid?
The IUPAC name of [4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid (CID 70866324) is [4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid.
What is the SMILES notation for [4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid?
The canonical SMILES for [4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid is CCOC(=O)C(C(=O)c1ccc(CS(=O)O)cc1)c1ccc(F)cc1F.
What is the InChIKey of [4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid?
The InChIKey is SDJPTZBMDCPQHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2O5S/c1-2-25-18(22)16(14-8-7-13(19)9-15(14)20)17(21)12-5-3-11(4-6-12)10-26(23)24/h3-9,16H,2,10H2,1H3,(H,23,24).
What are the key properties of [4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid?
[4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid has a molecular weight of 382.38 g/mol, XLogP of 3.22, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(2,4-difluorophenyl)-3-ethoxy-3-oxopropanoyl]phenyl]methanesulfinic acid is sourced from PubChem (CID 70866324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).