C21H26O5 — CID 70866389
6-ethyl-16-methyl-10-propyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1,5,13-triene-4,18-dione (PubChem CID 70866389) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is 6-ethyl-16-methyl-10-propyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1,5,13-triene-4,18-dione.
| Compound Name | 6-ethyl-16-methyl-10-propyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1,5,13-triene-4,18-dione |
|---|---|
| PubChem CID | 70866389 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 6-ethyl-16-methyl-10-propyl-3,9,15-trioxatetracyclo[12.4.0.02,7.08,13]octadeca-1,5,13-triene-4,18-dione |
| SMILES | CCCC1CCC2=C3OC(C)CC(=O)C3=C3OC(=O)C=C(CC)C3C2O1 |
| InChI | InChI=1S/C21H26O5/c1-4-6-13-7-8-14-19(25-13)17-12(5-2)10-16(23)26-21(17)18-15(22)9-11(3)24-20(14)18/h10-11,13,17,19H,4-9H2,1-3H3 |
| InChIKey | WKTRQGUXKTWTRM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |