C15H15ClN2 — CID 70866585
13-chloro-5-ethyl-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene (PubChem CID 70866585) has the molecular formula C15H15ClN2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 13-chloro-5-ethyl-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene.
| Compound Name | 13-chloro-5-ethyl-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene |
|---|---|
| PubChem CID | 70866585 |
| Molecular Formula | C15H15ClN2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 13-chloro-5-ethyl-3,4-diazatricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene |
| SMILES | CCc1cc2c(nn1)-c1ccc(Cl)cc1CCC2 |
| InChI | InChI=1S/C15H15ClN2/c1-2-13-9-11-5-3-4-10-8-12(16)6-7-14(10)15(11)18-17-13/h6-9H,2-5H2,1H3 |
| InChIKey | RXCBMEDZPZQNHO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |