C11H12F3N — CID 70866710
6-ethyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole (PubChem CID 70866710) has the molecular formula C11H12F3N and a molecular weight of 215.22 g/mol. Its IUPAC name is 6-ethyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole.
| Compound Name | 6-ethyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 70866710 |
| Molecular Formula | C11H12F3N |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 6-ethyl-2-(trifluoromethyl)-2,3-dihydro-1H-indole |
| SMILES | CCc1ccc2c(c1)NC(C(F)(F)F)C2 |
| InChI | InChI=1S/C11H12F3N/c1-2-7-3-4-8-6-10(11(12,13)14)15-9(8)5-7/h3-5,10,15H,2,6H2,1H3 |
| InChIKey | MAIOBPQJOHNYAW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |