About (2-methylcyclohexyl) 3-morpholin-4-ylpropanoate
(2-methylcyclohexyl) 3-morpholin-4-ylpropanoate (PubChem CID 70867557) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is (2-methylcyclohexyl) 3-morpholin-4-ylpropanoate.
Molecular Properties
| Compound Name | (2-methylcyclohexyl) 3-morpholin-4-ylpropanoate |
| PubChem CID | 70867557 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (2-methylcyclohexyl) 3-morpholin-4-ylpropanoate |
| SMILES | CC1CCCCC1OC(=O)CCN1CCOCC1 |
| InChI | InChI=1S/C14H25NO3/c1-12-4-2-3-5-13(12)18-14(16)6-7-15-8-10-17-11-9-15/h12-13H,2-11H2,1H3 |
| InChIKey | YQWRZUIQSWYBSU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methylcyclohexyl) 3-morpholin-4-ylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclohexyl) 3-morpholin-4-ylpropanoate?
The IUPAC name of (2-methylcyclohexyl) 3-morpholin-4-ylpropanoate (CID 70867557) is (2-methylcyclohexyl) 3-morpholin-4-ylpropanoate.
What is the SMILES notation for (2-methylcyclohexyl) 3-morpholin-4-ylpropanoate?
The canonical SMILES for (2-methylcyclohexyl) 3-morpholin-4-ylpropanoate is CC1CCCCC1OC(=O)CCN1CCOCC1.
What is the InChIKey of (2-methylcyclohexyl) 3-morpholin-4-ylpropanoate?
The InChIKey is YQWRZUIQSWYBSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO3/c1-12-4-2-3-5-13(12)18-14(16)6-7-15-8-10-17-11-9-15/h12-13H,2-11H2,1H3.
What are the key properties of (2-methylcyclohexyl) 3-morpholin-4-ylpropanoate?
(2-methylcyclohexyl) 3-morpholin-4-ylpropanoate has a molecular weight of 255.36 g/mol, XLogP of 1.83, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclohexyl) 3-morpholin-4-ylpropanoate is sourced from PubChem (CID 70867557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).