C15H19IN2 — CID 70867560
4-[(4-iodocyclohexa-1,3-dien-1-yl)iminomethyl]-N,N-dimethylcyclohexa-1,3-dien-1-amine (PubChem CID 70867560) has the molecular formula C15H19IN2 and a molecular weight of 354.24 g/mol. Its IUPAC name is 4-[(4-iodocyclohexa-1,3-dien-1-yl)iminomethyl]-N,N-dimethylcyclohexa-1,3-dien-1-amine.
| Compound Name | 4-[(4-iodocyclohexa-1,3-dien-1-yl)iminomethyl]-N,N-dimethylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 70867560 |
| Molecular Formula | C15H19IN2 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 4-[(4-iodocyclohexa-1,3-dien-1-yl)iminomethyl]-N,N-dimethylcyclohexa-1,3-dien-1-amine |
| SMILES | CN(C)C1=CC=C(/C=N/C2=CC=C(I)CC2)CC1 |
| InChI | InChI=1S/C15H19IN2/c1-18(2)15-9-3-12(4-10-15)11-17-14-7-5-13(16)6-8-14/h3,5,7,9,11H,4,6,8,10H2,1-2H3/b17-11+ |
| InChIKey | XREROGPSCYINJL-GZTJUZNOSA-N |
| XLogP | 4.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|