C24H20N2S2 — CID 70867567
5,6-bis(2,5-dimethylthiophen-3-yl)-1,10-phenanthroline (PubChem CID 70867567) has the molecular formula C24H20N2S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is 5,6-bis(2,5-dimethylthiophen-3-yl)-1,10-phenanthroline.
| Compound Name | 5,6-bis(2,5-dimethylthiophen-3-yl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 70867567 |
| Molecular Formula | C24H20N2S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 5,6-bis(2,5-dimethylthiophen-3-yl)-1,10-phenanthroline |
| SMILES | Cc1cc(-c2c(-c3cc(C)sc3C)c3cccnc3c3ncccc23)c(C)s1 |
| InChI | InChI=1S/C24H20N2S2/c1-13-11-19(15(3)27-13)21-17-7-5-9-25-23(17)24-18(8-6-10-26-24)22(21)20-12-14(2)28-16(20)4/h5-12H,1-4H3 |
| InChIKey | IKPWSVFNXYUDSX-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|