C19H24O4 — CID 70867850
(3'aR)-11'a-methylspiro[1,3-dioxolane-2,7'-3,3a,3b,5,6,8,9,11-octahydro-2H-indeno[4,5-c]isochromene]-1'-one (PubChem CID 70867850) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (3'aR)-11'a-methylspiro[1,3-dioxolane-2,7'-3,3a,3b,5,6,8,9,11-octahydro-2H-indeno[4,5-c]isochromene]-1'-one.
| Compound Name | (3'aR)-11'a-methylspiro[1,3-dioxolane-2,7'-3,3a,3b,5,6,8,9,11-octahydro-2H-indeno[4,5-c]isochromene]-1'-one |
|---|---|
| PubChem CID | 70867850 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (3'aR)-11'a-methylspiro[1,3-dioxolane-2,7'-3,3a,3b,5,6,8,9,11-octahydro-2H-indeno[4,5-c]isochromene]-1'-one |
| SMILES | CC12CC=C3C4=C(COC3[C@@H]1CCC2=O)CC1(CC4)OCCO1 |
| InChI | InChI=1S/C19H24O4/c1-18-6-4-14-13-5-7-19(22-8-9-23-19)10-12(13)11-21-17(14)15(18)2-3-16(18)20/h4,15,17H,2-3,5-11H2,1H3/t15-,17?,18?/m0/s1 |
| InChIKey | NVNZQFCQNWTMRF-ZLPCBKJTSA-N |
| XLogP | 2.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |