C19H14N2O6 — CID 70868013
N-(3,4-dihydroxyphenyl)-2-(4-nitrophenoxy)benzamide (PubChem CID 70868013) has the molecular formula C19H14N2O6 and a molecular weight of 366.33 g/mol. Its IUPAC name is N-(3,4-dihydroxyphenyl)-2-(4-nitrophenoxy)benzamide.
| Compound Name | N-(3,4-dihydroxyphenyl)-2-(4-nitrophenoxy)benzamide |
|---|---|
| PubChem CID | 70868013 |
| Molecular Formula | C19H14N2O6 |
| Molecular Weight | 366.33 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-(3,4-dihydroxyphenyl)-2-(4-nitrophenoxy)benzamide |
| SMILES | O=C(Nc1ccc(O)c(O)c1)c1ccccc1Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H14N2O6/c22-16-10-5-12(11-17(16)23)20-19(24)15-3-1-2-4-18(15)27-14-8-6-13(7-9-14)21(25)26/h1-11,22-23H,(H,20,24) |
| InChIKey | KPMGCHNYHXITTL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|