C22H20F3N5 — CID 70868088
2-phenyl-1-[3-(2H-tetrazol-5-yl)phenyl]-5-(trifluoromethyl)-2,3,4,5,6,7-hexahydroindole (PubChem CID 70868088) has the molecular formula C22H20F3N5 and a molecular weight of 411.43 g/mol. Its IUPAC name is 2-phenyl-1-[3-(2H-tetrazol-5-yl)phenyl]-5-(trifluoromethyl)-2,3,4,5,6,7-hexahydroindole.
| Compound Name | 2-phenyl-1-[3-(2H-tetrazol-5-yl)phenyl]-5-(trifluoromethyl)-2,3,4,5,6,7-hexahydroindole |
|---|---|
| PubChem CID | 70868088 |
| Molecular Formula | C22H20F3N5 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-phenyl-1-[3-(2H-tetrazol-5-yl)phenyl]-5-(trifluoromethyl)-2,3,4,5,6,7-hexahydroindole |
| SMILES | FC(F)(F)C1CCC2=C(CC(c3ccccc3)N2c2cccc(-c3nn[nH]n3)c2)C1 |
| InChI | InChI=1S/C22H20F3N5/c23-22(24,25)17-9-10-19-16(11-17)13-20(14-5-2-1-3-6-14)30(19)18-8-4-7-15(12-18)21-26-28-29-27-21/h1-8,12,17,20H,9-11,13H2,(H,26,27,28,29) |
| InChIKey | ZMVMHURZKPFUFC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |