C22H24ClN3O3 — CID 70868140
2-[4-[4-[(4-chlorophenyl)methyl]-1-oxophthalazin-2-yl]butyl-methylamino]acetic acid (PubChem CID 70868140) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is 2-[4-[4-[(4-chlorophenyl)methyl]-1-oxophthalazin-2-yl]butyl-methylamino]acetic acid.
| Compound Name | 2-[4-[4-[(4-chlorophenyl)methyl]-1-oxophthalazin-2-yl]butyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 70868140 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-[4-[4-[(4-chlorophenyl)methyl]-1-oxophthalazin-2-yl]butyl-methylamino]acetic acid |
| SMILES | CN(CCCCn1nc(Cc2ccc(Cl)cc2)c2ccccc2c1=O)CC(=O)O |
| InChI | InChI=1S/C22H24ClN3O3/c1-25(15-21(27)28)12-4-5-13-26-22(29)19-7-3-2-6-18(19)20(24-26)14-16-8-10-17(23)11-9-16/h2-3,6-11H,4-5,12-15H2,1H3,(H,27,28) |
| InChIKey | VVJYVXSFOCQFBU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|