About (3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate
(3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate (PubChem CID 70869466) has the molecular formula C11H17NO6
and a molecular weight of 259.26 g/mol. Its IUPAC name is (3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate.
Molecular Properties
| Compound Name | (3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate |
| PubChem CID | 70869466 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | (3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate |
| SMILES | O=COCC1([N+](=O)[O-])COC2(CCCCC2)OC1 |
| InChI | InChI=1S/C11H17NO6/c13-9-16-6-10(12(14)15)7-17-11(18-8-10)4-2-1-3-5-11/h9H,1-8H2 |
| InChIKey | CGHULWGQGWCMGA-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate?
The IUPAC name of (3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate (CID 70869466) is (3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate.
What is the SMILES notation for (3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate?
The canonical SMILES for (3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate is O=COCC1([N+](=O)[O-])COC2(CCCCC2)OC1.
What is the InChIKey of (3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate?
The InChIKey is CGHULWGQGWCMGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO6/c13-9-16-6-10(12(14)15)7-17-11(18-8-10)4-2-1-3-5-11/h9H,1-8H2.
What are the key properties of (3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate?
(3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate has a molecular weight of 259.26 g/mol, XLogP of 0.88, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-nitro-1,5-dioxaspiro[5.5]undecan-3-yl)methyl formate is sourced from PubChem (CID 70869466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).