C16H26O4 — CID 70869593
3-cyclohexylidene-4-ethoxy-2,2-diethyl-4-oxobutanoic acid (PubChem CID 70869593) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 3-cyclohexylidene-4-ethoxy-2,2-diethyl-4-oxobutanoic acid.
| Compound Name | 3-cyclohexylidene-4-ethoxy-2,2-diethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70869593 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 3-cyclohexylidene-4-ethoxy-2,2-diethyl-4-oxobutanoic acid |
| SMILES | CCOC(=O)C(=C1CCCCC1)C(CC)(CC)C(=O)O |
| InChI | InChI=1S/C16H26O4/c1-4-16(5-2,15(18)19)13(14(17)20-6-3)12-10-8-7-9-11-12/h4-11H2,1-3H3,(H,18,19) |
| InChIKey | KQWMLFOVGYRUNQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|