C33H22N6S — CID 70870176
2-[3-(1,10-phenanthrolin-5-yl)-5-(1-phenyl-4,5-dihydrotriazol-4-yl)phenyl]-1,3-benzothiazole (PubChem CID 70870176) has the molecular formula C33H22N6S and a molecular weight of 534.65 g/mol. Its IUPAC name is 2-[3-(1,10-phenanthrolin-5-yl)-5-(1-phenyl-4,5-dihydrotriazol-4-yl)phenyl]-1,3-benzothiazole.
| Compound Name | 2-[3-(1,10-phenanthrolin-5-yl)-5-(1-phenyl-4,5-dihydrotriazol-4-yl)phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 70870176 |
| Molecular Formula | C33H22N6S |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 2-[3-(1,10-phenanthrolin-5-yl)-5-(1-phenyl-4,5-dihydrotriazol-4-yl)phenyl]-1,3-benzothiazole |
| SMILES | c1ccc(N2CC(c3cc(-c4nc5ccccc5s4)cc(-c4cc5cccnc5c5ncccc45)c3)N=N2)cc1 |
| InChI | InChI=1S/C33H22N6S/c1-2-9-25(10-3-1)39-20-29(37-38-39)23-16-22(17-24(18-23)33-36-28-12-4-5-13-30(28)40-33)27-19-21-8-6-14-34-31(21)32-26(27)11-7-15-35-32/h1-19,29H,20H2 |
| InChIKey | YVPUCXZMYSLBHX-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 66.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|