C30H36N4O2 — CID 70870668
5-[1-(2-cyclopropyl-3-oxo-1,4-diazaspiro[4.6]undec-1-en-4-yl)propan-2-yl]spiro[1,3-dihydroindene-2,3'-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine]-2'-one (PubChem CID 70870668) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is 5-[1-(2-cyclopropyl-3-oxo-1,4-diazaspiro[4.6]undec-1-en-4-yl)propan-2-yl]spiro[1,3-dihydroindene-2,3'-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine]-2'-one.
| Compound Name | 5-[1-(2-cyclopropyl-3-oxo-1,4-diazaspiro[4.6]undec-1-en-4-yl)propan-2-yl]spiro[1,3-dihydroindene-2,3'-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine]-2'-one |
|---|---|
| PubChem CID | 70870668 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 5-[1-(2-cyclopropyl-3-oxo-1,4-diazaspiro[4.6]undec-1-en-4-yl)propan-2-yl]spiro[1,3-dihydroindene-2,3'-6,7-dihydro-1H-pyrrolo[2,3-b]pyridine]-2'-one |
| SMILES | CC(CN1C(=O)C(C2CC2)=NC12CCCCCC2)c1ccc2c(c1)CC1(C2)C(=O)NC2=C1C=CCN2 |
| InChI | InChI=1S/C30H36N4O2/c1-19(18-34-27(35)25(20-8-9-20)33-30(34)12-4-2-3-5-13-30)21-10-11-22-16-29(17-23(22)15-21)24-7-6-14-31-26(24)32-28(29)36/h6-7,10-11,15,19-20,31H,2-5,8-9,12-14,16-18H2,1H3,(H,32,36) |
| InChIKey | WVJAXFYDEBKSQS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |