About N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide
N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide (PubChem CID 70870752) has the molecular formula C12H26N2O2S
and a molecular weight of 262.42 g/mol. Its IUPAC name is N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide.
Molecular Properties
| Compound Name | N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide |
| PubChem CID | 70870752 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide |
| SMILES | CN[C@H](CN(C)S(=O)(=O)C1CC1)CC(C)(C)C |
| InChI | InChI=1S/C12H26N2O2S/c1-12(2,3)8-10(13-4)9-14(5)17(15,16)11-6-7-11/h10-11,13H,6-9H2,1-5H3/t10-/m0/s1 |
| InChIKey | UFRSLYWNSVBBSP-JTQLQIEISA-N |
| XLogP | 1.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide?
The IUPAC name of N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide (CID 70870752) is N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide.
What is the SMILES notation for N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide?
The canonical SMILES for N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide is CN[C@H](CN(C)S(=O)(=O)C1CC1)CC(C)(C)C.
What is the InChIKey of N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide?
The InChIKey is UFRSLYWNSVBBSP-JTQLQIEISA-N. The full InChI is InChI=1S/C12H26N2O2S/c1-12(2,3)8-10(13-4)9-14(5)17(15,16)11-6-7-11/h10-11,13H,6-9H2,1-5H3/t10-/m0/s1.
What are the key properties of N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide?
N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide has a molecular weight of 262.42 g/mol, XLogP of 1.43, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-4,4-dimethyl-2-(methylamino)pentyl]-N-methylcyclopropanesulfonamide is sourced from PubChem (CID 70870752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).