About (1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine
(1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine (PubChem CID 70870754) has the molecular formula C11H25N3O2S
and a molecular weight of 263.41 g/mol. Its IUPAC name is (1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | (1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine |
| PubChem CID | 70870754 |
| Molecular Formula | C11H25N3O2S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine |
| SMILES | CN(C)S(=O)(=O)N(C)C[C@@H](N)C1CCCCC1 |
| InChI | InChI=1S/C11H25N3O2S/c1-13(2)17(15,16)14(3)9-11(12)10-7-5-4-6-8-10/h10-11H,4-9,12H2,1-3H3/t11-/m1/s1 |
| InChIKey | CVDBVQVNVPNZJT-LLVKDONJSA-N |
| XLogP | 0.63 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine?
The IUPAC name of (1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine (CID 70870754) is (1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for (1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine?
The canonical SMILES for (1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine is CN(C)S(=O)(=O)N(C)C[C@@H](N)C1CCCCC1.
What is the InChIKey of (1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine?
The InChIKey is CVDBVQVNVPNZJT-LLVKDONJSA-N. The full InChI is InChI=1S/C11H25N3O2S/c1-13(2)17(15,16)14(3)9-11(12)10-7-5-4-6-8-10/h10-11H,4-9,12H2,1-3H3/t11-/m1/s1.
What are the key properties of (1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine?
(1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine has a molecular weight of 263.41 g/mol, XLogP of 0.63, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-cyclohexyl-N'-(dimethylsulfamoyl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 70870754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).