About 2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one
2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one (PubChem CID 70870893) has the molecular formula C8H8N2O3S
and a molecular weight of 212.23 g/mol. Its IUPAC name is 2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
| PubChem CID | 70870893 |
| Molecular Formula | C8H8N2O3S |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
| SMILES | NC1C(=O)Nc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C8H8N2O3S/c9-7-8(11)10-5-3-1-2-4-6(5)14(7,12)13/h1-4,7H,9H2,(H,10,11) |
| InChIKey | DTFMKXZVFFFJQL-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
The IUPAC name of 2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one (CID 70870893) is 2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one.
What is the SMILES notation for 2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
The canonical SMILES for 2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one is NC1C(=O)Nc2ccccc2S1(=O)=O.
What is the InChIKey of 2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
The InChIKey is DTFMKXZVFFFJQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O3S/c9-7-8(11)10-5-3-1-2-4-6(5)14(7,12)13/h1-4,7H,9H2,(H,10,11).
What are the key properties of 2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one?
2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one has a molecular weight of 212.23 g/mol, XLogP of -0.30, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one is sourced from PubChem (CID 70870893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).