About [3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate
[3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate (PubChem CID 70870949) has the molecular formula C17H24N2O7Si
and a molecular weight of 396.47 g/mol. Its IUPAC name is [3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate.
Molecular Properties
| Compound Name | [3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate |
| PubChem CID | 70870949 |
| Molecular Formula | C17H24N2O7Si |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate |
| SMILES | CC(=O)OCC(COC(C)=O)OCn1cc(C#C[Si](C)(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C17H24N2O7Si/c1-12(20)24-9-15(10-25-13(2)21)26-11-19-8-14(6-7-27(3,4)5)16(22)18-17(19)23/h8,15H,9-11H2,1-5H3,(H,18,22,23) |
| InChIKey | RRPLIAZWCFJKEC-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate?
The IUPAC name of [3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate (CID 70870949) is [3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate.
What is the SMILES notation for [3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate?
The canonical SMILES for [3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate is CC(=O)OCC(COC(C)=O)OCn1cc(C#C[Si](C)(C)C)c(=O)[nH]c1=O.
What is the InChIKey of [3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate?
The InChIKey is RRPLIAZWCFJKEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O7Si/c1-12(20)24-9-15(10-25-13(2)21)26-11-19-8-14(6-7-27(3,4)5)16(22)18-17(19)23/h8,15H,9-11H2,1-5H3,(H,18,22,23).
What are the key properties of [3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate?
[3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate has a molecular weight of 396.47 g/mol, XLogP of 0.23, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [3-acetyloxy-2-[[2,4-dioxo-5-(2-trimethylsilylethynyl)pyrimidin-1-yl]methoxy]propyl] acetate is sourced from PubChem (CID 70870949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).