C15H25N — CID 70871098
3-methyl-1-pentyl-5,5a,6,7,8,8a-hexahydrocyclopenta[c]azepine (PubChem CID 70871098) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 3-methyl-1-pentyl-5,5a,6,7,8,8a-hexahydrocyclopenta[c]azepine.
| Compound Name | 3-methyl-1-pentyl-5,5a,6,7,8,8a-hexahydrocyclopenta[c]azepine |
|---|---|
| PubChem CID | 70871098 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 3-methyl-1-pentyl-5,5a,6,7,8,8a-hexahydrocyclopenta[c]azepine |
| SMILES | CCCCCC1=NC(C)=CCC2CCCC12 |
| InChI | InChI=1S/C15H25N/c1-3-4-5-9-15-14-8-6-7-13(14)11-10-12(2)16-15/h10,13-14H,3-9,11H2,1-2H3 |
| InChIKey | WEFVKPWHLQAODB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|