C9H17NO6 — CID 70871295
(3R,4R,5R,6S)-4,5,6-trihydroxy-3-methoxy-2,2-dimethyloxane-4-carboxamide (PubChem CID 70871295) has the molecular formula C9H17NO6 and a molecular weight of 235.24 g/mol. Its IUPAC name is (3R,4R,5R,6S)-4,5,6-trihydroxy-3-methoxy-2,2-dimethyloxane-4-carboxamide.
| Compound Name | (3R,4R,5R,6S)-4,5,6-trihydroxy-3-methoxy-2,2-dimethyloxane-4-carboxamide |
|---|---|
| PubChem CID | 70871295 |
| Molecular Formula | C9H17NO6 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | (3R,4R,5R,6S)-4,5,6-trihydroxy-3-methoxy-2,2-dimethyloxane-4-carboxamide |
| SMILES | CO[C@H]1C(C)(C)O[C@H](O)[C@H](O)[C@]1(O)C(N)=O |
| InChI | InChI=1S/C9H17NO6/c1-8(2)6(15-3)9(14,7(10)13)4(11)5(12)16-8/h4-6,11-12,14H,1-3H3,(H2,10,13)/t4-,5-,6-,9+/m0/s1 |
| InChIKey | KCHJDSCZGUOAIO-WWSLTDMBSA-N |
| XLogP | -2.29 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |