C22H15N5O2 — CID 70871614
4-[3-[[3-(5-hydroxypyrimidin-2-yl)phenyl]methyl]-4-oxopyridazin-1-yl]benzonitrile (PubChem CID 70871614) has the molecular formula C22H15N5O2 and a molecular weight of 381.40 g/mol. Its IUPAC name is 4-[3-[[3-(5-hydroxypyrimidin-2-yl)phenyl]methyl]-4-oxopyridazin-1-yl]benzonitrile.
| Compound Name | 4-[3-[[3-(5-hydroxypyrimidin-2-yl)phenyl]methyl]-4-oxopyridazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 70871614 |
| Molecular Formula | C22H15N5O2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 4-[3-[[3-(5-hydroxypyrimidin-2-yl)phenyl]methyl]-4-oxopyridazin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(-n2ccc(=O)c(Cc3cccc(-c4ncc(O)cn4)c3)n2)cc1 |
| InChI | InChI=1S/C22H15N5O2/c23-12-15-4-6-18(7-5-15)27-9-8-21(29)20(26-27)11-16-2-1-3-17(10-16)22-24-13-19(28)14-25-22/h1-10,13-14,28H,11H2 |
| InChIKey | DIROVMLYSGUVLL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |