About CID 70871806
CID 70871806 (PubChem CID 70871806) has the molecular formula C37H29Cl2F3N2O3
and a molecular weight of 677.55 g/mol.
Molecular Properties
| Compound Name | CID 70871806 |
| PubChem CID | 70871806 |
| Molecular Formula | C37H29Cl2F3N2O3 |
| Molecular Weight | 677.55 g/mol |
| Exact Mass | 676.15 |
| IUPAC Name | — |
| SMILES | O=C1O[C@@H](c2ccccc2)[C@@H](c2ccccc2)N2[C@@H]1[C@H](c1cccc(Cl)c1F)[C@@]1(C(=O)Nc3cc(Cl)ccc31)C21CC(CF)(CF)C1 |
| InChI | InChI=1S/C37H29Cl2F3N2O3/c38-23-14-15-25-27(16-23)43-34(46)37(25)28(24-12-7-13-26(39)29(24)42)31-33(45)47-32(22-10-5-2-6-11-22)30(21-8-3-1-4-9-21)44(31)36(37)17-35(18-36,19-40)20-41/h1-16,28,30-32H,17-20H2,(H,43,46)/t28-,30+,31+,32-,37-/m0/s1 |
| InChIKey | IEXKQXXBFMMFKQ-JBOJVOFWSA-N |
| XLogP | 8.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 677.55 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 70871806 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70871806?
The IUPAC name of CID 70871806 (CID 70871806) is not available.
What is the SMILES notation for CID 70871806?
The canonical SMILES for CID 70871806 is O=C1O[C@@H](c2ccccc2)[C@@H](c2ccccc2)N2[C@@H]1[C@H](c1cccc(Cl)c1F)[C@@]1(C(=O)Nc3cc(Cl)ccc31)C21CC(CF)(CF)C1.
What is the InChIKey of CID 70871806?
The InChIKey is IEXKQXXBFMMFKQ-JBOJVOFWSA-N. The full InChI is InChI=1S/C37H29Cl2F3N2O3/c38-23-14-15-25-27(16-23)43-34(46)37(25)28(24-12-7-13-26(39)29(24)42)31-33(45)47-32(22-10-5-2-6-11-22)30(21-8-3-1-4-9-21)44(31)36(37)17-35(18-36,19-40)20-41/h1-16,28,30-32H,17-20H2,(H,43,46)/t28-,30+,31+,32-,37-/m0/s1.
What are the key properties of CID 70871806?
CID 70871806 has a molecular weight of 677.55 g/mol, XLogP of 8.29, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70871806 is sourced from PubChem (CID 70871806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).