C7H12ClN3O2 — CID 70871863
(3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-amine;hydrochloride (PubChem CID 70871863) has the molecular formula C7H12ClN3O2 and a molecular weight of 205.65 g/mol. Its IUPAC name is (3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-amine;hydrochloride.
| Compound Name | (3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-amine;hydrochloride |
|---|---|
| PubChem CID | 70871863 |
| Molecular Formula | C7H12ClN3O2 |
| Molecular Weight | 205.65 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | (3R,6S)-6-(1,2,4-oxadiazol-3-yl)oxan-3-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CC[C@@H](c2ncon2)OC1 |
| InChI | InChI=1S/C7H11N3O2.ClH/c8-5-1-2-6(11-3-5)7-9-4-12-10-7;/h4-6H,1-3,8H2;1H/t5-,6+;/m1./s1 |
| InChIKey | OXKSWFGZVZYSBP-IBTYICNHSA-N |
| XLogP | 0.67 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.65 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |