About SCHEMBL13275893
SCHEMBL13275893 (PubChem CID 70872006) has the molecular formula C37H29Cl2F3N2O3
and a molecular weight of 677.55 g/mol.
Molecular Properties
| Compound Name | SCHEMBL13275893 |
| PubChem CID | 70872006 |
| Molecular Formula | C37H29Cl2F3N2O3 |
| Molecular Weight | 677.55 g/mol |
| Exact Mass | 676.15 |
| IUPAC Name | — |
| SMILES | O=C1O[C@@H](c2ccccc2)[C@@H](c2ccccc2)N2[C@@H]1[C@H](c1cc(F)cc(Cl)c1)[C@@]1(C(=O)Nc3cc(Cl)ccc31)C21CC(CF)(CF)C1 |
| InChI | InChI=1S/C37H29Cl2F3N2O3/c38-24-11-12-27-28(16-24)43-34(46)37(27)29(23-13-25(39)15-26(42)14-23)31-33(45)47-32(22-9-5-2-6-10-22)30(21-7-3-1-4-8-21)44(31)36(37)17-35(18-36,19-40)20-41/h1-16,29-32H,17-20H2,(H,43,46)/t29-,30+,31+,32-,37-/m0/s1 |
| InChIKey | KOMPLYYZWFGRDG-LDVVUSEQSA-N |
| XLogP | 8.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 677.55 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze SCHEMBL13275893 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of SCHEMBL13275893?
The IUPAC name of SCHEMBL13275893 (CID 70872006) is not available.
What is the SMILES notation for SCHEMBL13275893?
The canonical SMILES for SCHEMBL13275893 is O=C1O[C@@H](c2ccccc2)[C@@H](c2ccccc2)N2[C@@H]1[C@H](c1cc(F)cc(Cl)c1)[C@@]1(C(=O)Nc3cc(Cl)ccc31)C21CC(CF)(CF)C1.
What is the InChIKey of SCHEMBL13275893?
The InChIKey is KOMPLYYZWFGRDG-LDVVUSEQSA-N. The full InChI is InChI=1S/C37H29Cl2F3N2O3/c38-24-11-12-27-28(16-24)43-34(46)37(27)29(23-13-25(39)15-26(42)14-23)31-33(45)47-32(22-9-5-2-6-10-22)30(21-7-3-1-4-8-21)44(31)36(37)17-35(18-36,19-40)20-41/h1-16,29-32H,17-20H2,(H,43,46)/t29-,30+,31+,32-,37-/m0/s1.
What are the key properties of SCHEMBL13275893?
SCHEMBL13275893 has a molecular weight of 677.55 g/mol, XLogP of 8.29, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for SCHEMBL13275893 is sourced from PubChem (CID 70872006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).