About SCHEMBL13275953
SCHEMBL13275953 (PubChem CID 70872025) has the molecular formula C39H35Cl2FN2O3
and a molecular weight of 669.62 g/mol.
Molecular Properties
| Compound Name | SCHEMBL13275953 |
| PubChem CID | 70872025 |
| Molecular Formula | C39H35Cl2FN2O3 |
| Molecular Weight | 669.62 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CC1)N1[C@H](c3ccccc3)[C@H](c3ccccc3)OC(=O)[C@H]1[C@H](c1cccc(Cl)c1F)[C@@]21C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C39H35Cl2FN2O3/c1-37(2)18-20-38(21-19-37)39(27-17-16-25(40)22-29(27)43-36(39)46)30(26-14-9-15-28(41)31(26)42)33-35(45)47-34(24-12-7-4-8-13-24)32(44(33)38)23-10-5-3-6-11-23/h3-17,22,30,32-34H,18-21H2,1-2H3,(H,43,46)/t30-,32+,33+,34-,39-/m0/s1 |
| InChIKey | RKWXISQDUIXGEE-VTAIYWPPSA-N |
| XLogP | 9.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 669.62 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze SCHEMBL13275953 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of SCHEMBL13275953?
The IUPAC name of SCHEMBL13275953 (CID 70872025) is not available.
What is the SMILES notation for SCHEMBL13275953?
The canonical SMILES for SCHEMBL13275953 is CC1(C)CCC2(CC1)N1[C@H](c3ccccc3)[C@H](c3ccccc3)OC(=O)[C@H]1[C@H](c1cccc(Cl)c1F)[C@@]21C(=O)Nc2cc(Cl)ccc21.
What is the InChIKey of SCHEMBL13275953?
The InChIKey is RKWXISQDUIXGEE-VTAIYWPPSA-N. The full InChI is InChI=1S/C39H35Cl2FN2O3/c1-37(2)18-20-38(21-19-37)39(27-17-16-25(40)22-29(27)43-36(39)46)30(26-14-9-15-28(41)31(26)42)33-35(45)47-34(24-12-7-4-8-13-24)32(44(33)38)23-10-5-3-6-11-23/h3-17,22,30,32-34H,18-21H2,1-2H3,(H,43,46)/t30-,32+,33+,34-,39-/m0/s1.
What are the key properties of SCHEMBL13275953?
SCHEMBL13275953 has a molecular weight of 669.62 g/mol, XLogP of 9.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for SCHEMBL13275953 is sourced from PubChem (CID 70872025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).