About N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide
N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide (PubChem CID 70872049) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide |
| PubChem CID | 70872049 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)CN1[C@@H]2CCC[C@H]1CC2 |
| InChI | InChI=1S/C12H22N2O2/c1-9(15)13-7-12(16)8-14-10-3-2-4-11(14)6-5-10/h10-12,16H,2-8H2,1H3,(H,13,15)/t10-,11+,12? |
| InChIKey | CSPSYYWVFVQOJE-FOSCPWQOSA-N |
| XLogP | 0.50 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide?
The IUPAC name of N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide (CID 70872049) is N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide.
What is the SMILES notation for N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide?
The canonical SMILES for N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide is CC(=O)NCC(O)CN1[C@@H]2CCC[C@H]1CC2.
What is the InChIKey of N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide?
The InChIKey is CSPSYYWVFVQOJE-FOSCPWQOSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-9(15)13-7-12(16)8-14-10-3-2-4-11(14)6-5-10/h10-12,16H,2-8H2,1H3,(H,13,15)/t10-,11+,12?.
What are the key properties of N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide?
N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide has a molecular weight of 226.32 g/mol, XLogP of 0.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-2-hydroxypropyl]acetamide is sourced from PubChem (CID 70872049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).