C45H66N6O6 — CID 70872087
N-[4,6-bis[bis(cyclohexanecarbonyl)amino]-1,3,5-triazin-2-yl]-N-(cyclohexanecarbonyl)cyclohexanecarboxamide (PubChem CID 70872087) has the molecular formula C45H66N6O6 and a molecular weight of 787.06 g/mol. Its IUPAC name is N-[4,6-bis[bis(cyclohexanecarbonyl)amino]-1,3,5-triazin-2-yl]-N-(cyclohexanecarbonyl)cyclohexanecarboxamide.
| Compound Name | N-[4,6-bis[bis(cyclohexanecarbonyl)amino]-1,3,5-triazin-2-yl]-N-(cyclohexanecarbonyl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 70872087 |
| Molecular Formula | C45H66N6O6 |
| Molecular Weight | 787.06 g/mol |
| Exact Mass | 786.50 |
| IUPAC Name | N-[4,6-bis[bis(cyclohexanecarbonyl)amino]-1,3,5-triazin-2-yl]-N-(cyclohexanecarbonyl)cyclohexanecarboxamide |
| SMILES | O=C(C1CCCCC1)N(C(=O)C1CCCCC1)c1nc(N(C(=O)C2CCCCC2)C(=O)C2CCCCC2)nc(N(C(=O)C2CCCCC2)C(=O)C2CCCCC2)n1 |
| InChI | InChI=1S/C45H66N6O6/c52-37(31-19-7-1-8-20-31)49(38(53)32-21-9-2-10-22-32)43-46-44(50(39(54)33-23-11-3-12-24-33)40(55)34-25-13-4-14-26-34)48-45(47-43)51(41(56)35-27-15-5-16-28-35)42(57)36-29-17-6-18-30-36/h31-36H,1-30H2 |
| InChIKey | NYVJQNOUNUUBBW-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 150.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.06 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|