C31H45F2N5O10S — CID 70872192
(E)-3-[4-[4-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide (PubChem CID 70872192) has the molecular formula C31H45F2N5O10S and a molecular weight of 717.79 g/mol. Its IUPAC name is (E)-3-[4-[4-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide.
| Compound Name | (E)-3-[4-[4-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 70872192 |
| Molecular Formula | C31H45F2N5O10S |
| Molecular Weight | 717.79 g/mol |
| Exact Mass | 717.29 |
| IUPAC Name | (E)-3-[4-[4-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethylsulfamoyl]phenoxy]-3,5-difluorophenyl]-N-(diaminomethylidene)-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1cc(F)c(Oc2ccc(S(=O)(=O)NCCOCCOCCOCCOCCOCCOCCN)cc2)c(F)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C31H45F2N5O10S/c1-23(30(39)38-31(35)36)20-24-21-27(32)29(28(33)22-24)48-25-2-4-26(5-3-25)49(40,41)37-7-9-43-11-13-45-15-17-47-19-18-46-16-14-44-12-10-42-8-6-34/h2-5,20-22,37H,6-19,34H2,1H3,(H4,35,36,38,39)/b23-20+ |
| InChIKey | VQSATWNLRLVRSM-BSYVCWPDSA-N |
| XLogP | 1.30 |
| TPSA | 218.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.79 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|