C15H17BrF3NO3 — CID 70872356
5-bromo-2-methyl-3-[oxan-4-yl(2,2,2-trifluoroethyl)amino]benzoic acid (PubChem CID 70872356) has the molecular formula C15H17BrF3NO3 and a molecular weight of 396.20 g/mol. Its IUPAC name is 5-bromo-2-methyl-3-[oxan-4-yl(2,2,2-trifluoroethyl)amino]benzoic acid.
| Compound Name | 5-bromo-2-methyl-3-[oxan-4-yl(2,2,2-trifluoroethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 70872356 |
| Molecular Formula | C15H17BrF3NO3 |
| Molecular Weight | 396.20 g/mol |
| Exact Mass | 395.03 |
| IUPAC Name | 5-bromo-2-methyl-3-[oxan-4-yl(2,2,2-trifluoroethyl)amino]benzoic acid |
| SMILES | Cc1c(C(=O)O)cc(Br)cc1N(CC(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C15H17BrF3NO3/c1-9-12(14(21)22)6-10(16)7-13(9)20(8-15(17,18)19)11-2-4-23-5-3-11/h6-7,11H,2-5,8H2,1H3,(H,21,22) |
| InChIKey | SKUGOAYBECOCBK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |