C21H28N2O2 — CID 7087258
2-(1,2-dimethylindol-3-yl)-2-oxo-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]acetamide (PubChem CID 7087258) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 2-(1,2-dimethylindol-3-yl)-2-oxo-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]acetamide.
| Compound Name | 2-(1,2-dimethylindol-3-yl)-2-oxo-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 7087258 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 2-(1,2-dimethylindol-3-yl)-2-oxo-N-[(1R,5S)-3,3,5-trimethylcyclohexyl]acetamide |
| SMILES | Cc1c(C(=O)C(=O)N[C@@H]2C[C@@H](C)CC(C)(C)C2)c2ccccc2n1C |
| InChI | InChI=1S/C21H28N2O2/c1-13-10-15(12-21(3,4)11-13)22-20(25)19(24)18-14(2)23(5)17-9-7-6-8-16(17)18/h6-9,13,15H,10-12H2,1-5H3,(H,22,25)/t13-,15-/m1/s1 |
| InChIKey | RVCJYDXUZIEUKO-UKRRQHHQSA-N |
| XLogP | 4.00 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|