C25H32N2O4 — CID 70872605
methyl 2-methyl-5-[4-(morpholin-4-ylmethyl)phenyl]-3-(oxan-4-ylamino)benzoate (PubChem CID 70872605) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is methyl 2-methyl-5-[4-(morpholin-4-ylmethyl)phenyl]-3-(oxan-4-ylamino)benzoate.
| Compound Name | methyl 2-methyl-5-[4-(morpholin-4-ylmethyl)phenyl]-3-(oxan-4-ylamino)benzoate |
|---|---|
| PubChem CID | 70872605 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | methyl 2-methyl-5-[4-(morpholin-4-ylmethyl)phenyl]-3-(oxan-4-ylamino)benzoate |
| SMILES | COC(=O)c1cc(-c2ccc(CN3CCOCC3)cc2)cc(NC2CCOCC2)c1C |
| InChI | InChI=1S/C25H32N2O4/c1-18-23(25(28)29-2)15-21(16-24(18)26-22-7-11-30-12-8-22)20-5-3-19(4-6-20)17-27-9-13-31-14-10-27/h3-6,15-16,22,26H,7-14,17H2,1-2H3 |
| InChIKey | YOKDDRWABFTKGH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |